C15H21N3O3 — CID 70229286
tert-butyl N-[1-[6-(hydroxymethyl)-1H-benzimidazol-2-yl]ethyl]carbamate (PubChem CID 70229286) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is tert-butyl N-[1-[6-(hydroxymethyl)-1H-benzimidazol-2-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[1-[6-(hydroxymethyl)-1H-benzimidazol-2-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 70229286 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | tert-butyl N-[1-[6-(hydroxymethyl)-1H-benzimidazol-2-yl]ethyl]carbamate |
| SMILES | CC(NC(=O)OC(C)(C)C)c1nc2ccc(CO)cc2[nH]1 |
| InChI | InChI=1S/C15H21N3O3/c1-9(16-14(20)21-15(2,3)4)13-17-11-6-5-10(8-19)7-12(11)18-13/h5-7,9,19H,8H2,1-4H3,(H,16,20)(H,17,18) |
| InChIKey | BQHDRRQOAUGLEM-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |