C14H17F2N3O2 — CID 70920856
tert-butyl N-[(1R)-1-(5,6-difluoro-1H-benzimidazol-2-yl)ethyl]carbamate (PubChem CID 70920856) has the molecular formula C14H17F2N3O2 and a molecular weight of 297.31 g/mol. Its IUPAC name is tert-butyl N-[(1R)-1-(5,6-difluoro-1H-benzimidazol-2-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-[(1R)-1-(5,6-difluoro-1H-benzimidazol-2-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 70920856 |
| Molecular Formula | C14H17F2N3O2 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | tert-butyl N-[(1R)-1-(5,6-difluoro-1H-benzimidazol-2-yl)ethyl]carbamate |
| SMILES | C[C@@H](NC(=O)OC(C)(C)C)c1nc2cc(F)c(F)cc2[nH]1 |
| InChI | InChI=1S/C14H17F2N3O2/c1-7(17-13(20)21-14(2,3)4)12-18-10-5-8(15)9(16)6-11(10)19-12/h5-7H,1-4H3,(H,17,20)(H,18,19)/t7-/m1/s1 |
| InChIKey | XKCLIHPIPBKLML-SSDOTTSWSA-N |
| XLogP | 3.43 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |