C14H22N2O2Si — CID 174054342
[2-[ethoxy(trimethylsilyl)methyl]-3H-benzimidazol-5-yl]methanol (PubChem CID 174054342) has the molecular formula C14H22N2O2Si and a molecular weight of 278.43 g/mol. Its IUPAC name is [2-[ethoxy(trimethylsilyl)methyl]-3H-benzimidazol-5-yl]methanol.
| Compound Name | [2-[ethoxy(trimethylsilyl)methyl]-3H-benzimidazol-5-yl]methanol |
|---|---|
| PubChem CID | 174054342 |
| Molecular Formula | C14H22N2O2Si |
| Molecular Weight | 278.43 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | [2-[ethoxy(trimethylsilyl)methyl]-3H-benzimidazol-5-yl]methanol |
| SMILES | CCOC(c1nc2ccc(CO)cc2[nH]1)[Si](C)(C)C |
| InChI | InChI=1S/C14H22N2O2Si/c1-5-18-14(19(2,3)4)13-15-11-7-6-10(9-17)8-12(11)16-13/h6-8,14,17H,5,9H2,1-4H3,(H,15,16) |
| InChIKey | RQTTUFIEPLKTKS-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 58.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.43 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|