C15H22N2O2Si — CID 69170903
CID 69170903 (PubChem CID 69170903) has the molecular formula C15H22N2O2Si and a molecular weight of 290.44 g/mol.
| Compound Name | CID 69170903 |
|---|---|
| PubChem CID | 69170903 |
| Molecular Formula | C15H22N2O2Si |
| Molecular Weight | 290.44 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | — |
| SMILES | CC(C)(C)[Si]OC(C)(C)c1nc2ccc(CO)cc2[nH]1 |
| InChI | InChI=1S/C15H22N2O2Si/c1-14(2,3)20-19-15(4,5)13-16-11-7-6-10(9-18)8-12(11)17-13/h6-8,18H,9H2,1-5H3,(H,16,17) |
| InChIKey | KRZPWTZMDSJFKK-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 58.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.44 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|