C14H13N3O — CID 66602187
[2-(3-methyl-2-pyridinyl)-3H-benzimidazol-5-yl]methanol (PubChem CID 66602187) has the molecular formula C14H13N3O and a molecular weight of 239.28 g/mol. Its IUPAC name is [2-(3-methyl-2-pyridinyl)-3H-benzimidazol-5-yl]methanol.
| Compound Name | [2-(3-methyl-2-pyridinyl)-3H-benzimidazol-5-yl]methanol |
|---|---|
| PubChem CID | 66602187 |
| Molecular Formula | C14H13N3O |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | [2-(3-methyl-2-pyridinyl)-3H-benzimidazol-5-yl]methanol |
| SMILES | Cc1cccnc1-c1nc2ccc(CO)cc2[nH]1 |
| InChI | InChI=1S/C14H13N3O/c1-9-3-2-6-15-13(9)14-16-11-5-4-10(8-18)7-12(11)17-14/h2-7,18H,8H2,1H3,(H,16,17) |
| InChIKey | QUEZPXFMPWRTGY-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |