C15H14N2O2 — CID 136813316
2-(6-ethyl-1H-benzimidazol-2-yl)benzene-1,3-diol (PubChem CID 136813316) has the molecular formula C15H14N2O2 and a molecular weight of 254.29 g/mol. Its IUPAC name is 2-(6-ethyl-1H-benzimidazol-2-yl)benzene-1,3-diol.
| Compound Name | 2-(6-ethyl-1H-benzimidazol-2-yl)benzene-1,3-diol |
|---|---|
| PubChem CID | 136813316 |
| Molecular Formula | C15H14N2O2 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 2-(6-ethyl-1H-benzimidazol-2-yl)benzene-1,3-diol |
| SMILES | CCc1ccc2nc(-c3c(O)cccc3O)[nH]c2c1 |
| InChI | InChI=1S/C15H14N2O2/c1-2-9-6-7-10-11(8-9)17-15(16-10)14-12(18)4-3-5-13(14)19/h3-8,18-19H,2H2,1H3,(H,16,17) |
| InChIKey | UEAWOBGTJQMSBZ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 69.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |