C15H12F3N3 — CID 114909124
6-ethyl-2-[5-(trifluoromethyl)-2-pyridinyl]-1H-benzimidazole (PubChem CID 114909124) has the molecular formula C15H12F3N3 and a molecular weight of 291.28 g/mol. Its IUPAC name is 6-ethyl-2-[5-(trifluoromethyl)-2-pyridinyl]-1H-benzimidazole.
| Compound Name | 6-ethyl-2-[5-(trifluoromethyl)-2-pyridinyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 114909124 |
| Molecular Formula | C15H12F3N3 |
| Molecular Weight | 291.28 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 6-ethyl-2-[5-(trifluoromethyl)-2-pyridinyl]-1H-benzimidazole |
| SMILES | CCc1ccc2nc(-c3ccc(C(F)(F)F)cn3)[nH]c2c1 |
| InChI | InChI=1S/C15H12F3N3/c1-2-9-3-5-11-13(7-9)21-14(20-11)12-6-4-10(8-19-12)15(16,17)18/h3-8H,2H2,1H3,(H,20,21) |
| InChIKey | JNMGISGIYHJATC-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.28 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |