C30H22F6N6O4Y-2 — CID 161029747
bis(2-(5-ethoxy-2-pyridinyl)-6-(trifluoromethoxy)-1H-benzimidazole);yttrium (PubChem CID 161029747) has the molecular formula C30H22F6N6O4Y-2 and a molecular weight of 733.44 g/mol. Its IUPAC name is bis(2-(5-ethoxy-2-pyridinyl)-6-(trifluoromethoxy)-1H-benzimidazole);yttrium.
| Compound Name | bis(2-(5-ethoxy-2-pyridinyl)-6-(trifluoromethoxy)-1H-benzimidazole);yttrium |
|---|---|
| PubChem CID | 161029747 |
| Molecular Formula | C30H22F6N6O4Y-2 |
| Molecular Weight | 733.44 g/mol |
| Exact Mass | 733.07 |
| IUPAC Name | bis(2-(5-ethoxy-2-pyridinyl)-6-(trifluoromethoxy)-1H-benzimidazole);yttrium |
| SMILES | [CH2-]COc1ccc(-c2nc3ccc(OC(F)(F)F)cc3[nH]2)nc1.[CH2-]COc1ccc(-c2nc3ccc(OC(F)(F)F)cc3[nH]2)nc1.[Y] |
| InChI | InChI=1S/2C15H11F3N3O2.Y/c2*1-2-22-10-4-6-12(19-8-10)14-20-11-5-3-9(7-13(11)21-14)23-15(16,17)18;/h2*3-8H,1-2H2,(H,20,21);/q2*-1; |
| InChIKey | MLSBHCAKAJXUTD-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 120.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.44 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|