C12H6F5N5O — CID 167848282
8-[5-(1,1,2,2,2-pentafluoroethoxy)-2-pyridinyl]-7H-purine (PubChem CID 167848282) has the molecular formula C12H6F5N5O and a molecular weight of 331.20 g/mol. Its IUPAC name is 8-[5-(1,1,2,2,2-pentafluoroethoxy)-2-pyridinyl]-7H-purine.
| Compound Name | 8-[5-(1,1,2,2,2-pentafluoroethoxy)-2-pyridinyl]-7H-purine |
|---|---|
| PubChem CID | 167848282 |
| Molecular Formula | C12H6F5N5O |
| Molecular Weight | 331.20 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | 8-[5-(1,1,2,2,2-pentafluoroethoxy)-2-pyridinyl]-7H-purine |
| SMILES | FC(F)(F)C(F)(F)Oc1ccc(-c2nc3ncncc3[nH]2)nc1 |
| InChI | InChI=1S/C12H6F5N5O/c13-11(14,15)12(16,17)23-6-1-2-7(19-3-6)10-21-8-4-18-5-20-9(8)22-10/h1-5H,(H,18,20,21,22) |
| InChIKey | SMZGREIKGNUXID-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.20 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|