C13H12N4O2 — CID 114402502
8-(2,5-dimethoxyphenyl)-7H-purine (PubChem CID 114402502) has the molecular formula C13H12N4O2 and a molecular weight of 256.26 g/mol. Its IUPAC name is 8-(2,5-dimethoxyphenyl)-7H-purine.
| Compound Name | 8-(2,5-dimethoxyphenyl)-7H-purine |
|---|---|
| PubChem CID | 114402502 |
| Molecular Formula | C13H12N4O2 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 8-(2,5-dimethoxyphenyl)-7H-purine |
| SMILES | COc1ccc(OC)c(-c2nc3ncncc3[nH]2)c1 |
| InChI | InChI=1S/C13H12N4O2/c1-18-8-3-4-11(19-2)9(5-8)12-16-10-6-14-7-15-13(10)17-12/h3-7H,1-2H3,(H,14,15,16,17) |
| InChIKey | IYFBLPGPBPAMQD-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |