C14H14N4O3 — CID 114402745
8-(3,4,5-trimethoxyphenyl)-7H-purine (PubChem CID 114402745) has the molecular formula C14H14N4O3 and a molecular weight of 286.29 g/mol. Its IUPAC name is 8-(3,4,5-trimethoxyphenyl)-7H-purine.
| Compound Name | 8-(3,4,5-trimethoxyphenyl)-7H-purine |
|---|---|
| PubChem CID | 114402745 |
| Molecular Formula | C14H14N4O3 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 8-(3,4,5-trimethoxyphenyl)-7H-purine |
| SMILES | COc1cc(-c2nc3ncncc3[nH]2)cc(OC)c1OC |
| InChI | InChI=1S/C14H14N4O3/c1-19-10-4-8(5-11(20-2)12(10)21-3)13-17-9-6-15-7-16-14(9)18-13/h4-7H,1-3H3,(H,15,16,17,18) |
| InChIKey | QJCCAGBNYGLHPF-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 82.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |