C17H18N2O3 — CID 924719
6-methyl-2-(3,4,5-trimethoxyphenyl)-1H-benzimidazole (PubChem CID 924719) has the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. Its IUPAC name is 6-methyl-2-(3,4,5-trimethoxyphenyl)-1H-benzimidazole.
| Compound Name | 6-methyl-2-(3,4,5-trimethoxyphenyl)-1H-benzimidazole |
|---|---|
| PubChem CID | 924719 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 6-methyl-2-(3,4,5-trimethoxyphenyl)-1H-benzimidazole |
| SMILES | COc1cc(-c2nc3ccc(C)cc3[nH]2)cc(OC)c1OC |
| InChI | InChI=1S/C17H18N2O3/c1-10-5-6-12-13(7-10)19-17(18-12)11-8-14(20-2)16(22-4)15(9-11)21-3/h5-9H,1-4H3,(H,18,19) |
| InChIKey | YRQAJIDNKFIRPY-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 56.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |