C17H18N2O — CID 146582271
2-(4-methoxy-3,5-dimethylphenyl)-6-methyl-1H-benzimidazole (PubChem CID 146582271) has the molecular formula C17H18N2O and a molecular weight of 266.34 g/mol. Its IUPAC name is 2-(4-methoxy-3,5-dimethylphenyl)-6-methyl-1H-benzimidazole.
| Compound Name | 2-(4-methoxy-3,5-dimethylphenyl)-6-methyl-1H-benzimidazole |
|---|---|
| PubChem CID | 146582271 |
| Molecular Formula | C17H18N2O |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 2-(4-methoxy-3,5-dimethylphenyl)-6-methyl-1H-benzimidazole |
| SMILES | COc1c(C)cc(-c2nc3ccc(C)cc3[nH]2)cc1C |
| InChI | InChI=1S/C17H18N2O/c1-10-5-6-14-15(7-10)19-17(18-14)13-8-11(2)16(20-4)12(3)9-13/h5-9H,1-4H3,(H,18,19) |
| InChIKey | SZAGNPUJIOGSRE-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |