2-(2,5-dimethoxyphenyl)-3H-benzimidazole-5-carboxylic acid

C16H14N2O4 — CID 26370448

IUPAC2-(2,5-dimethoxyphenyl)-3H-benzimidazole-5-carboxylic acid
SMILESCOc1ccc(OC)c(-c2nc3ccc(C(=O)O)cc3[nH]2)c1
InChIInChI=1S/C16H14N2O4/c1-21-10-4-6-14(22-2)11(8-10)15-17-12-5-3-9(16(19)20)7-13(12)18-15/h3-8H,1-2H3,(H,17,18)(H,19,20)
InChIKeyWOUDRFOZPQYMFW-UHFFFAOYSA-N
MW298.30 g/mol
LogP2.95
Rot. Bonds4

About 2-(2,5-dimethoxyphenyl)-3H-benzimidazole-5-carboxylic acid

2-(2,5-dimethoxyphenyl)-3H-benzimidazole-5-carboxylic acid (PubChem CID 26370448) has the molecular formula C16H14N2O4 and a molecular weight of 298.30 g/mol. Its IUPAC name is 2-(2,5-dimethoxyphenyl)-3H-benzimidazole-5-carboxylic acid.

Molecular Properties

Compound Name2-(2,5-dimethoxyphenyl)-3H-benzimidazole-5-carboxylic acid
PubChem CID26370448
Molecular FormulaC16H14N2O4
Molecular Weight298.30 g/mol
Exact Mass298.10
IUPAC Name2-(2,5-dimethoxyphenyl)-3H-benzimidazole-5-carboxylic acid
SMILESCOc1ccc(OC)c(-c2nc3ccc(C(=O)O)cc3[nH]2)c1
InChIInChI=1S/C16H14N2O4/c1-21-10-4-6-14(22-2)11(8-10)15-17-12-5-3-9(16(19)20)7-13(12)18-15/h3-8H,1-2H3,(H,17,18)(H,19,20)
InChIKeyWOUDRFOZPQYMFW-UHFFFAOYSA-N
XLogP2.95
TPSA84.44 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500298.30
LogP ≤ 52.95
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-(2,5-dimethoxyphenyl)-3H-benzimidazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,5-dimethoxyphenyl)-3H-benzimidazole-5-carboxylic acid?
The IUPAC name of 2-(2,5-dimethoxyphenyl)-3H-benzimidazole-5-carboxylic acid (CID 26370448) is 2-(2,5-dimethoxyphenyl)-3H-benzimidazole-5-carboxylic acid.
What is the SMILES notation for 2-(2,5-dimethoxyphenyl)-3H-benzimidazole-5-carboxylic acid?
The canonical SMILES for 2-(2,5-dimethoxyphenyl)-3H-benzimidazole-5-carboxylic acid is COc1ccc(OC)c(-c2nc3ccc(C(=O)O)cc3[nH]2)c1.
What is the InChIKey of 2-(2,5-dimethoxyphenyl)-3H-benzimidazole-5-carboxylic acid?
The InChIKey is WOUDRFOZPQYMFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2O4/c1-21-10-4-6-14(22-2)11(8-10)15-17-12-5-3-9(16(19)20)7-13(12)18-15/h3-8H,1-2H3,(H,17,18)(H,19,20).
What are the key properties of 2-(2,5-dimethoxyphenyl)-3H-benzimidazole-5-carboxylic acid?
2-(2,5-dimethoxyphenyl)-3H-benzimidazole-5-carboxylic acid has a molecular weight of 298.30 g/mol, XLogP of 2.95, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dimethoxyphenyl)-3H-benzimidazole-5-carboxylic acid is sourced from PubChem (CID 26370448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).