C15H13N3O4 — CID 110538644
2-(2,5-dimethoxyphenyl)-6-nitro-1H-benzimidazole (PubChem CID 110538644) has the molecular formula C15H13N3O4 and a molecular weight of 299.29 g/mol. Its IUPAC name is 2-(2,5-dimethoxyphenyl)-6-nitro-1H-benzimidazole.
| Compound Name | 2-(2,5-dimethoxyphenyl)-6-nitro-1H-benzimidazole |
|---|---|
| PubChem CID | 110538644 |
| Molecular Formula | C15H13N3O4 |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 2-(2,5-dimethoxyphenyl)-6-nitro-1H-benzimidazole |
| SMILES | COc1ccc(OC)c(-c2nc3ccc([N+](=O)[O-])cc3[nH]2)c1 |
| InChI | InChI=1S/C15H13N3O4/c1-21-10-4-6-14(22-2)11(8-10)15-16-12-5-3-9(18(19)20)7-13(12)17-15/h3-8H,1-2H3,(H,16,17) |
| InChIKey | KNMSJSUAYCHUAX-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 90.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|