C16H15N5O5 — CID 166593690
2-[2-methoxy-4-(6-nitro-1H-benzimidazol-2-yl)phenoxy]acetohydrazide (PubChem CID 166593690) has the molecular formula C16H15N5O5 and a molecular weight of 357.33 g/mol. Its IUPAC name is 2-[2-methoxy-4-(6-nitro-1H-benzimidazol-2-yl)phenoxy]acetohydrazide.
| Compound Name | 2-[2-methoxy-4-(6-nitro-1H-benzimidazol-2-yl)phenoxy]acetohydrazide |
|---|---|
| PubChem CID | 166593690 |
| Molecular Formula | C16H15N5O5 |
| Molecular Weight | 357.33 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 2-[2-methoxy-4-(6-nitro-1H-benzimidazol-2-yl)phenoxy]acetohydrazide |
| SMILES | COc1cc(-c2nc3ccc([N+](=O)[O-])cc3[nH]2)ccc1OCC(=O)NN |
| InChI | InChI=1S/C16H15N5O5/c1-25-14-6-9(2-5-13(14)26-8-15(22)20-17)16-18-11-4-3-10(21(23)24)7-12(11)19-16/h2-7H,8,17H2,1H3,(H,18,19)(H,20,22) |
| InChIKey | BOEYSMAAKVFETG-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 145.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.33 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|