C16H16N4O3 — CID 91902915
2-(3,4-dimethoxyphenyl)-3H-benzimidazole-5-carbohydrazide (PubChem CID 91902915) has the molecular formula C16H16N4O3 and a molecular weight of 312.33 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-3H-benzimidazole-5-carbohydrazide.
| Compound Name | 2-(3,4-dimethoxyphenyl)-3H-benzimidazole-5-carbohydrazide |
|---|---|
| PubChem CID | 91902915 |
| Molecular Formula | C16H16N4O3 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-3H-benzimidazole-5-carbohydrazide |
| SMILES | COc1ccc(-c2nc3ccc(C(=O)NN)cc3[nH]2)cc1OC |
| InChI | InChI=1S/C16H16N4O3/c1-22-13-6-4-9(8-14(13)23-2)15-18-11-5-3-10(16(21)20-17)7-12(11)19-15/h3-8H,17H2,1-2H3,(H,18,19)(H,20,21) |
| InChIKey | SHJFRVALZNACPM-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|