C14H11BrN4O — CID 91673674
2-(4-bromophenyl)-3H-benzimidazole-5-carbohydrazide (PubChem CID 91673674) has the molecular formula C14H11BrN4O and a molecular weight of 331.17 g/mol. Its IUPAC name is 2-(4-bromophenyl)-3H-benzimidazole-5-carbohydrazide.
| Compound Name | 2-(4-bromophenyl)-3H-benzimidazole-5-carbohydrazide |
|---|---|
| PubChem CID | 91673674 |
| Molecular Formula | C14H11BrN4O |
| Molecular Weight | 331.17 g/mol |
| Exact Mass | 330.01 |
| IUPAC Name | 2-(4-bromophenyl)-3H-benzimidazole-5-carbohydrazide |
| SMILES | NNC(=O)c1ccc2nc(-c3ccc(Br)cc3)[nH]c2c1 |
| InChI | InChI=1S/C14H11BrN4O/c15-10-4-1-8(2-5-10)13-17-11-6-3-9(14(20)19-16)7-12(11)18-13/h1-7H,16H2,(H,17,18)(H,19,20) |
| InChIKey | PSKXDAPDJFOVED-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.17 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|