C21H14F3N3O2 — CID 122690134
N-hydroxy-2-[4-[4-(trifluoromethyl)phenyl]phenyl]-3H-benzimidazole-5-carboxamide (PubChem CID 122690134) has the molecular formula C21H14F3N3O2 and a molecular weight of 397.36 g/mol. Its IUPAC name is N-hydroxy-2-[4-[4-(trifluoromethyl)phenyl]phenyl]-3H-benzimidazole-5-carboxamide.
| Compound Name | N-hydroxy-2-[4-[4-(trifluoromethyl)phenyl]phenyl]-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 122690134 |
| Molecular Formula | C21H14F3N3O2 |
| Molecular Weight | 397.36 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | N-hydroxy-2-[4-[4-(trifluoromethyl)phenyl]phenyl]-3H-benzimidazole-5-carboxamide |
| SMILES | O=C(NO)c1ccc2nc(-c3ccc(-c4ccc(C(F)(F)F)cc4)cc3)[nH]c2c1 |
| InChI | InChI=1S/C21H14F3N3O2/c22-21(23,24)16-8-5-13(6-9-16)12-1-3-14(4-2-12)19-25-17-10-7-15(20(28)27-29)11-18(17)26-19/h1-11,29H,(H,25,26)(H,27,28) |
| InChIKey | WXYCYIMRUYUPEO-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.36 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|