C23H18F3N3O2 — CID 71731266
N-(2-hydroxyethyl)-4-[4-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]phenyl]benzamide (PubChem CID 71731266) has the molecular formula C23H18F3N3O2 and a molecular weight of 425.41 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-4-[4-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]phenyl]benzamide.
| Compound Name | N-(2-hydroxyethyl)-4-[4-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 71731266 |
| Molecular Formula | C23H18F3N3O2 |
| Molecular Weight | 425.41 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | N-(2-hydroxyethyl)-4-[4-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]phenyl]benzamide |
| SMILES | O=C(NCCO)c1ccc(-c2ccc(-c3nc4ccc(C(F)(F)F)cc4[nH]3)cc2)cc1 |
| InChI | InChI=1S/C23H18F3N3O2/c24-23(25,26)18-9-10-19-20(13-18)29-21(28-19)16-5-1-14(2-6-16)15-3-7-17(8-4-15)22(31)27-11-12-30/h1-10,13,30H,11-12H2,(H,27,31)(H,28,29) |
| InChIKey | JHUATWQNDUUMHX-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.41 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |