C15H11F3N4O — CID 137187151
N'-hydroxy-4-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]benzenecarboximidamide (PubChem CID 137187151) has the molecular formula C15H11F3N4O and a molecular weight of 320.27 g/mol. Its IUPAC name is N'-hydroxy-4-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]benzenecarboximidamide.
| Compound Name | N'-hydroxy-4-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 137187151 |
| Molecular Formula | C15H11F3N4O |
| Molecular Weight | 320.27 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | N'-hydroxy-4-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]benzenecarboximidamide |
| SMILES | N/C(=N/O)c1ccc(-c2nc3ccc(C(F)(F)F)cc3[nH]2)cc1 |
| InChI | InChI=1S/C15H11F3N4O/c16-15(17,18)10-5-6-11-12(7-10)21-14(20-11)9-3-1-8(2-4-9)13(19)22-23/h1-7,23H,(H2,19,22)(H,20,21) |
| InChIKey | XGJCSQXRHBNQGJ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 87.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.27 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|