C14H9F4N3 — CID 81455212
2-fluoro-5-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]aniline (PubChem CID 81455212) has the molecular formula C14H9F4N3 and a molecular weight of 295.24 g/mol. Its IUPAC name is 2-fluoro-5-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]aniline.
| Compound Name | 2-fluoro-5-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]aniline |
|---|---|
| PubChem CID | 81455212 |
| Molecular Formula | C14H9F4N3 |
| Molecular Weight | 295.24 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 2-fluoro-5-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]aniline |
| SMILES | Nc1cc(-c2nc3ccc(C(F)(F)F)cc3[nH]2)ccc1F |
| InChI | InChI=1S/C14H9F4N3/c15-9-3-1-7(5-10(9)19)13-20-11-4-2-8(14(16,17)18)6-12(11)21-13/h1-6H,19H2,(H,20,21) |
| InChIKey | YDTSOLAKYAPQHL-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.24 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|