C14H12F3N3 — CID 161338412
molecular hydrogen;4-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]aniline (PubChem CID 161338412) has the molecular formula C14H12F3N3 and a molecular weight of 279.26 g/mol. Its IUPAC name is molecular hydrogen;4-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]aniline.
| Compound Name | molecular hydrogen;4-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]aniline |
|---|---|
| PubChem CID | 161338412 |
| Molecular Formula | C14H12F3N3 |
| Molecular Weight | 279.26 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | molecular hydrogen;4-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]aniline |
| SMILES | Nc1ccc(-c2nc3ccc(C(F)(F)F)cc3[nH]2)cc1.[H][H] |
| InChI | InChI=1S/C14H10F3N3.H2/c15-14(16,17)9-3-6-11-12(7-9)20-13(19-11)8-1-4-10(18)5-2-8;/h1-7H,18H2,(H,19,20);1H |
| InChIKey | VMIQVKYMKXRDFA-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.26 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|