C22H18F3N5O2 — CID 71730104
4-[[5-[4-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]phenyl]pyrimidin-2-yl]amino]butanoic acid (PubChem CID 71730104) has the molecular formula C22H18F3N5O2 and a molecular weight of 441.41 g/mol. Its IUPAC name is 4-[[5-[4-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]phenyl]pyrimidin-2-yl]amino]butanoic acid.
| Compound Name | 4-[[5-[4-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]phenyl]pyrimidin-2-yl]amino]butanoic acid |
|---|---|
| PubChem CID | 71730104 |
| Molecular Formula | C22H18F3N5O2 |
| Molecular Weight | 441.41 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | 4-[[5-[4-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]phenyl]pyrimidin-2-yl]amino]butanoic acid |
| SMILES | O=C(O)CCCNc1ncc(-c2ccc(-c3nc4ccc(C(F)(F)F)cc4[nH]3)cc2)cn1 |
| InChI | InChI=1S/C22H18F3N5O2/c23-22(24,25)16-7-8-17-18(10-16)30-20(29-17)14-5-3-13(4-6-14)15-11-27-21(28-12-15)26-9-1-2-19(31)32/h3-8,10-12H,1-2,9H2,(H,29,30)(H,31,32)(H,26,27,28) |
| InChIKey | RWBBMXSNBMPOII-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 103.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.41 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|