C14H14BrN3O2 — CID 116975177
4-[[5-(4-bromophenyl)pyrimidin-2-yl]amino]butanoic acid (PubChem CID 116975177) has the molecular formula C14H14BrN3O2 and a molecular weight of 336.19 g/mol. Its IUPAC name is 4-[[5-(4-bromophenyl)pyrimidin-2-yl]amino]butanoic acid.
| Compound Name | 4-[[5-(4-bromophenyl)pyrimidin-2-yl]amino]butanoic acid |
|---|---|
| PubChem CID | 116975177 |
| Molecular Formula | C14H14BrN3O2 |
| Molecular Weight | 336.19 g/mol |
| Exact Mass | 335.03 |
| IUPAC Name | 4-[[5-(4-bromophenyl)pyrimidin-2-yl]amino]butanoic acid |
| SMILES | O=C(O)CCCNc1ncc(-c2ccc(Br)cc2)cn1 |
| InChI | InChI=1S/C14H14BrN3O2/c15-12-5-3-10(4-6-12)11-8-17-14(18-9-11)16-7-1-2-13(19)20/h3-6,8-9H,1-2,7H2,(H,19,20)(H,16,17,18) |
| InChIKey | NCTLVHITFPRPCF-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.19 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|