C12H12N4O2 — CID 116975157
3-[(5-pyridin-2-ylpyrimidin-2-yl)amino]propanoic acid (PubChem CID 116975157) has the molecular formula C12H12N4O2 and a molecular weight of 244.25 g/mol. Its IUPAC name is 3-[(5-pyridin-2-ylpyrimidin-2-yl)amino]propanoic acid.
| Compound Name | 3-[(5-pyridin-2-ylpyrimidin-2-yl)amino]propanoic acid |
|---|---|
| PubChem CID | 116975157 |
| Molecular Formula | C12H12N4O2 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 3-[(5-pyridin-2-ylpyrimidin-2-yl)amino]propanoic acid |
| SMILES | O=C(O)CCNc1ncc(-c2ccccn2)cn1 |
| InChI | InChI=1S/C12H12N4O2/c17-11(18)4-6-14-12-15-7-9(8-16-12)10-3-1-2-5-13-10/h1-3,5,7-8H,4,6H2,(H,17,18)(H,14,15,16) |
| InChIKey | FWTMLAWVNPCDKF-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |