About formyl chloride;2-phenylpyridine
formyl chloride;2-phenylpyridine (PubChem CID 175066008) has the molecular formula C12H10ClNO
and a molecular weight of 219.67 g/mol. Its IUPAC name is formyl chloride;2-phenylpyridine.
Molecular Properties
| Compound Name | formyl chloride;2-phenylpyridine |
| PubChem CID | 175066008 |
| Molecular Formula | C12H10ClNO |
| Molecular Weight | 219.67 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | formyl chloride;2-phenylpyridine |
| SMILES | O=CCl.c1ccc(-c2ccccn2)cc1 |
| InChI | InChI=1S/C11H9N.CHClO/c1-2-6-10(7-3-1)11-8-4-5-9-12-11;2-1-3/h1-9H;1H |
| InChIKey | LCLVWTNHTSJJGM-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.67 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze formyl chloride;2-phenylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formyl chloride;2-phenylpyridine?
The IUPAC name of formyl chloride;2-phenylpyridine (CID 175066008) is formyl chloride;2-phenylpyridine.
What is the SMILES notation for formyl chloride;2-phenylpyridine?
The canonical SMILES for formyl chloride;2-phenylpyridine is O=CCl.c1ccc(-c2ccccn2)cc1.
What is the InChIKey of formyl chloride;2-phenylpyridine?
The InChIKey is LCLVWTNHTSJJGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N.CHClO/c1-2-6-10(7-3-1)11-8-4-5-9-12-11;2-1-3/h1-9H;1H.
What are the key properties of formyl chloride;2-phenylpyridine?
formyl chloride;2-phenylpyridine has a molecular weight of 219.67 g/mol, XLogP of 3.16, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for formyl chloride;2-phenylpyridine is sourced from PubChem (CID 175066008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).