C10H10Cl2N2 — CID 67024611
2-pyridin-3-ylpyridine;dihydrochloride (PubChem CID 67024611) has the molecular formula C10H10Cl2N2 and a molecular weight of 229.11 g/mol. Its IUPAC name is 2-pyridin-3-ylpyridine;dihydrochloride.
| Compound Name | 2-pyridin-3-ylpyridine;dihydrochloride |
|---|---|
| PubChem CID | 67024611 |
| Molecular Formula | C10H10Cl2N2 |
| Molecular Weight | 229.11 g/mol |
| Exact Mass | 228.02 |
| IUPAC Name | 2-pyridin-3-ylpyridine;dihydrochloride |
| SMILES | Cl.Cl.c1ccc(-c2cccnc2)nc1 |
| InChI | InChI=1S/C10H8N2.2ClH/c1-2-7-12-10(5-1)9-4-3-6-11-8-9;;/h1-8H;2*1H |
| InChIKey | MWTDUDXELRPIKG-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.11 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |