C16H12N2Pt+2 — CID 161405876
2-phenyl-6-pyridin-2-ylpyridine;platinum(2+) (PubChem CID 161405876) has the molecular formula C16H12N2Pt+2 and a molecular weight of 427.36 g/mol. Its IUPAC name is 2-phenyl-6-pyridin-2-ylpyridine;platinum(2+).
| Compound Name | 2-phenyl-6-pyridin-2-ylpyridine;platinum(2+) |
|---|---|
| PubChem CID | 161405876 |
| Molecular Formula | C16H12N2Pt+2 |
| Molecular Weight | 427.36 g/mol |
| Exact Mass | 427.06 |
| IUPAC Name | 2-phenyl-6-pyridin-2-ylpyridine;platinum(2+) |
| SMILES | [Pt+2].c1ccc(-c2cccc(-c3ccccn3)n2)cc1 |
| InChI | InChI=1S/C16H12N2.Pt/c1-2-7-13(8-3-1)14-10-6-11-16(18-14)15-9-4-5-12-17-15;/h1-12H;/q;+2 |
| InChIKey | VUVDQNDOGULBFI-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.36 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |