C51H33N9 — CID 58090473
2,4,6-tris[3-(6-pyridin-2-yl-2-pyridinyl)phenyl]-1,3,5-triazine (PubChem CID 58090473) has the molecular formula C51H33N9 and a molecular weight of 771.89 g/mol. Its IUPAC name is 2,4,6-tris[3-(6-pyridin-2-yl-2-pyridinyl)phenyl]-1,3,5-triazine.
| Compound Name | 2,4,6-tris[3-(6-pyridin-2-yl-2-pyridinyl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 58090473 |
| Molecular Formula | C51H33N9 |
| Molecular Weight | 771.89 g/mol |
| Exact Mass | 771.29 |
| IUPAC Name | 2,4,6-tris[3-(6-pyridin-2-yl-2-pyridinyl)phenyl]-1,3,5-triazine |
| SMILES | c1ccc(-c2cccc(-c3cccc(-c4nc(-c5cccc(-c6cccc(-c7ccccn7)n6)c5)nc(-c5cccc(-c6cccc(-c7ccccn7)n6)c5)n4)c3)n2)nc1 |
| InChI | InChI=1S/C51H33N9/c1-4-28-52-43(19-1)46-25-10-22-40(55-46)34-13-7-16-37(31-34)49-58-50(38-17-8-14-35(32-38)41-23-11-26-47(56-41)44-20-2-5-29-53-44)60-51(59-49)39-18-9-15-36(33-39)42-24-12-27-48(57-42)45-21-3-6-30-54-45/h1-33H |
| InChIKey | VVLPRSPAKUEOBF-UHFFFAOYSA-N |
| XLogP | 11.24 |
| TPSA | 116.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.89 |
| LogP ≤ 5 | 11.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |