C29H19N7 — CID 59273782
2-phenyl-4,6-bis(6-pyridin-2-yl-2-pyridinyl)-1,3,5-triazine (PubChem CID 59273782) has the molecular formula C29H19N7 and a molecular weight of 465.52 g/mol. Its IUPAC name is 2-phenyl-4,6-bis(6-pyridin-2-yl-2-pyridinyl)-1,3,5-triazine.
| Compound Name | 2-phenyl-4,6-bis(6-pyridin-2-yl-2-pyridinyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 59273782 |
| Molecular Formula | C29H19N7 |
| Molecular Weight | 465.52 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | 2-phenyl-4,6-bis(6-pyridin-2-yl-2-pyridinyl)-1,3,5-triazine |
| SMILES | c1ccc(-c2nc(-c3cccc(-c4ccccn4)n3)nc(-c3cccc(-c4ccccn4)n3)n2)cc1 |
| InChI | InChI=1S/C29H19N7/c1-2-10-20(11-3-1)27-34-28(25-16-8-14-23(32-25)21-12-4-6-18-30-21)36-29(35-27)26-17-9-15-24(33-26)22-13-5-7-19-31-22/h1-19H |
| InChIKey | NDJFMWHHOHDKSL-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 90.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.52 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |