C39H25N7 — CID 59273746
2-(4-naphthalen-2-ylphenyl)-4,6-bis(6-pyridin-2-yl-2-pyridinyl)-1,3,5-triazine (PubChem CID 59273746) has the molecular formula C39H25N7 and a molecular weight of 591.68 g/mol. Its IUPAC name is 2-(4-naphthalen-2-ylphenyl)-4,6-bis(6-pyridin-2-yl-2-pyridinyl)-1,3,5-triazine.
| Compound Name | 2-(4-naphthalen-2-ylphenyl)-4,6-bis(6-pyridin-2-yl-2-pyridinyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 59273746 |
| Molecular Formula | C39H25N7 |
| Molecular Weight | 591.68 g/mol |
| Exact Mass | 591.22 |
| IUPAC Name | 2-(4-naphthalen-2-ylphenyl)-4,6-bis(6-pyridin-2-yl-2-pyridinyl)-1,3,5-triazine |
| SMILES | c1ccc(-c2cccc(-c3nc(-c4ccc(-c5ccc6ccccc6c5)cc4)nc(-c4cccc(-c5ccccn5)n4)n3)n2)nc1 |
| InChI | InChI=1S/C39H25N7/c1-2-10-29-25-30(22-19-26(29)9-1)27-17-20-28(21-18-27)37-44-38(35-15-7-13-33(42-35)31-11-3-5-23-40-31)46-39(45-37)36-16-8-14-34(43-36)32-12-4-6-24-41-32/h1-25H |
| InChIKey | IQAOLSAYLYLBCT-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 90.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.68 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |