C44H28N6 — CID 129208720
2-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-6-(2-pyridin-2-ylquinolin-6-yl)quinoline (PubChem CID 129208720) has the molecular formula C44H28N6 and a molecular weight of 640.75 g/mol. Its IUPAC name is 2-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-6-(2-pyridin-2-ylquinolin-6-yl)quinoline.
| Compound Name | 2-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-6-(2-pyridin-2-ylquinolin-6-yl)quinoline |
|---|---|
| PubChem CID | 129208720 |
| Molecular Formula | C44H28N6 |
| Molecular Weight | 640.75 g/mol |
| Exact Mass | 640.24 |
| IUPAC Name | 2-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-6-(2-pyridin-2-ylquinolin-6-yl)quinoline |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3cccc(-c4ccc5cc(-c6ccc7nc(-c8ccccn8)ccc7c6)ccc5n4)c3)n2)cc1 |
| InChI | InChI=1S/C44H28N6/c1-3-10-29(11-4-1)42-48-43(30-12-5-2-6-13-30)50-44(49-42)36-15-9-14-33(28-36)37-23-19-34-26-31(17-21-38(34)46-37)32-18-22-39-35(27-32)20-24-41(47-39)40-16-7-8-25-45-40/h1-28H |
| InChIKey | DLDKLCKODGUTDA-UHFFFAOYSA-N |
| XLogP | 10.36 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.75 |
| LogP ≤ 5 | 10.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |