C29H18BrN7 — CID 101456405
2-(4-bromophenyl)-4,6-bis(6-pyridin-2-yl-2-pyridinyl)-1,3,5-triazine (PubChem CID 101456405) has the molecular formula C29H18BrN7 and a molecular weight of 544.42 g/mol. Its IUPAC name is 2-(4-bromophenyl)-4,6-bis(6-pyridin-2-yl-2-pyridinyl)-1,3,5-triazine.
| Compound Name | 2-(4-bromophenyl)-4,6-bis(6-pyridin-2-yl-2-pyridinyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 101456405 |
| Molecular Formula | C29H18BrN7 |
| Molecular Weight | 544.42 g/mol |
| Exact Mass | 543.08 |
| IUPAC Name | 2-(4-bromophenyl)-4,6-bis(6-pyridin-2-yl-2-pyridinyl)-1,3,5-triazine |
| SMILES | Brc1ccc(-c2nc(-c3cccc(-c4ccccn4)n3)nc(-c3cccc(-c4ccccn4)n3)n2)cc1 |
| InChI | InChI=1S/C29H18BrN7/c30-20-15-13-19(14-16-20)27-35-28(25-11-5-9-23(33-25)21-7-1-3-17-31-21)37-29(36-27)26-12-6-10-24(34-26)22-8-2-4-18-32-22/h1-18H |
| InChIKey | LPYPKXNYPMLJOA-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 90.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.42 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |