About hydrazine;2-phenylpyridine
hydrazine;2-phenylpyridine (PubChem CID 158673997) has the molecular formula C11H17N5
and a molecular weight of 219.29 g/mol. Its IUPAC name is hydrazine;2-phenylpyridine.
Molecular Properties
| Compound Name | hydrazine;2-phenylpyridine |
| PubChem CID | 158673997 |
| Molecular Formula | C11H17N5 |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | hydrazine;2-phenylpyridine |
| SMILES | NN.NN.c1ccc(-c2ccccn2)cc1 |
| InChI | InChI=1S/C11H9N.2H4N2/c1-2-6-10(7-3-1)11-8-4-5-9-12-11;2*1-2/h1-9H;2*1-2H2 |
| InChIKey | IEHCHJKUIWMERX-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 116.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze hydrazine;2-phenylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydrazine;2-phenylpyridine?
The IUPAC name of hydrazine;2-phenylpyridine (CID 158673997) is hydrazine;2-phenylpyridine.
What is the SMILES notation for hydrazine;2-phenylpyridine?
The canonical SMILES for hydrazine;2-phenylpyridine is NN.NN.c1ccc(-c2ccccn2)cc1.
What is the InChIKey of hydrazine;2-phenylpyridine?
The InChIKey is IEHCHJKUIWMERX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N.2H4N2/c1-2-6-10(7-3-1)11-8-4-5-9-12-11;2*1-2/h1-9H;2*1-2H2.
What are the key properties of hydrazine;2-phenylpyridine?
hydrazine;2-phenylpyridine has a molecular weight of 219.29 g/mol, XLogP of 0.39, 1 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for hydrazine;2-phenylpyridine is sourced from PubChem (CID 158673997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).