C12H11N3O2 — CID 116975092
2-[(5-phenylpyrimidin-2-yl)amino]acetic acid (PubChem CID 116975092) has the molecular formula C12H11N3O2 and a molecular weight of 229.24 g/mol. Its IUPAC name is 2-[(5-phenylpyrimidin-2-yl)amino]acetic acid.
| Compound Name | 2-[(5-phenylpyrimidin-2-yl)amino]acetic acid |
|---|---|
| PubChem CID | 116975092 |
| Molecular Formula | C12H11N3O2 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 2-[(5-phenylpyrimidin-2-yl)amino]acetic acid |
| SMILES | O=C(O)CNc1ncc(-c2ccccc2)cn1 |
| InChI | InChI=1S/C12H11N3O2/c16-11(17)8-15-12-13-6-10(7-14-12)9-4-2-1-3-5-9/h1-7H,8H2,(H,16,17)(H,13,14,15) |
| InChIKey | GBKBQJDSZRBYKY-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |