C25H22N4O — CID 53108687
N-benzyl-4-[2-(benzylamino)pyrimidin-5-yl]benzamide (PubChem CID 53108687) has the molecular formula C25H22N4O and a molecular weight of 394.48 g/mol. Its IUPAC name is N-benzyl-4-[2-(benzylamino)pyrimidin-5-yl]benzamide.
| Compound Name | N-benzyl-4-[2-(benzylamino)pyrimidin-5-yl]benzamide |
|---|---|
| PubChem CID | 53108687 |
| Molecular Formula | C25H22N4O |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | N-benzyl-4-[2-(benzylamino)pyrimidin-5-yl]benzamide |
| SMILES | O=C(NCc1ccccc1)c1ccc(-c2cnc(NCc3ccccc3)nc2)cc1 |
| InChI | InChI=1S/C25H22N4O/c30-24(26-15-19-7-3-1-4-8-19)22-13-11-21(12-14-22)23-17-28-25(29-18-23)27-16-20-9-5-2-6-10-20/h1-14,17-18H,15-16H2,(H,26,30)(H,27,28,29) |
| InChIKey | ZWSXSFXYAJPDAS-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |