C24H19BrN4O — CID 53108676
4-[2-(benzylamino)pyrimidin-5-yl]-N-(3-bromophenyl)benzamide (PubChem CID 53108676) has the molecular formula C24H19BrN4O and a molecular weight of 459.35 g/mol. Its IUPAC name is 4-[2-(benzylamino)pyrimidin-5-yl]-N-(3-bromophenyl)benzamide.
| Compound Name | 4-[2-(benzylamino)pyrimidin-5-yl]-N-(3-bromophenyl)benzamide |
|---|---|
| PubChem CID | 53108676 |
| Molecular Formula | C24H19BrN4O |
| Molecular Weight | 459.35 g/mol |
| Exact Mass | 458.07 |
| IUPAC Name | 4-[2-(benzylamino)pyrimidin-5-yl]-N-(3-bromophenyl)benzamide |
| SMILES | O=C(Nc1cccc(Br)c1)c1ccc(-c2cnc(NCc3ccccc3)nc2)cc1 |
| InChI | InChI=1S/C24H19BrN4O/c25-21-7-4-8-22(13-21)29-23(30)19-11-9-18(10-12-19)20-15-27-24(28-16-20)26-14-17-5-2-1-3-6-17/h1-13,15-16H,14H2,(H,29,30)(H,26,27,28) |
| InChIKey | UOVQNOGOAZYNTB-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.35 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |