C26H24N4O2 — CID 53108666
4-[2-(benzylamino)pyrimidin-5-yl]-N-(2-ethoxyphenyl)benzamide (PubChem CID 53108666) has the molecular formula C26H24N4O2 and a molecular weight of 424.50 g/mol. Its IUPAC name is 4-[2-(benzylamino)pyrimidin-5-yl]-N-(2-ethoxyphenyl)benzamide.
| Compound Name | 4-[2-(benzylamino)pyrimidin-5-yl]-N-(2-ethoxyphenyl)benzamide |
|---|---|
| PubChem CID | 53108666 |
| Molecular Formula | C26H24N4O2 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 4-[2-(benzylamino)pyrimidin-5-yl]-N-(2-ethoxyphenyl)benzamide |
| SMILES | CCOc1ccccc1NC(=O)c1ccc(-c2cnc(NCc3ccccc3)nc2)cc1 |
| InChI | InChI=1S/C26H24N4O2/c1-2-32-24-11-7-6-10-23(24)30-25(31)21-14-12-20(13-15-21)22-17-28-26(29-18-22)27-16-19-8-4-3-5-9-19/h3-15,17-18H,2,16H2,1H3,(H,30,31)(H,27,28,29) |
| InChIKey | PLLKXDLKEBADJF-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |