C21H21N3O2 — CID 109231887
5-(benzylamino)-N-(2-ethoxyphenyl)pyridine-3-carboxamide (PubChem CID 109231887) has the molecular formula C21H21N3O2 and a molecular weight of 347.42 g/mol. Its IUPAC name is 5-(benzylamino)-N-(2-ethoxyphenyl)pyridine-3-carboxamide.
| Compound Name | 5-(benzylamino)-N-(2-ethoxyphenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109231887 |
| Molecular Formula | C21H21N3O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 5-(benzylamino)-N-(2-ethoxyphenyl)pyridine-3-carboxamide |
| SMILES | CCOc1ccccc1NC(=O)c1cncc(NCc2ccccc2)c1 |
| InChI | InChI=1S/C21H21N3O2/c1-2-26-20-11-7-6-10-19(20)24-21(25)17-12-18(15-22-14-17)23-13-16-8-4-3-5-9-16/h3-12,14-15,23H,2,13H2,1H3,(H,24,25) |
| InChIKey | MOWDAJQTIHSXNO-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |