C26H23ClN4O — CID 53108683
4-[2-(benzylamino)pyrimidin-5-yl]-N-[2-(4-chlorophenyl)ethyl]benzamide (PubChem CID 53108683) has the molecular formula C26H23ClN4O and a molecular weight of 442.95 g/mol. Its IUPAC name is 4-[2-(benzylamino)pyrimidin-5-yl]-N-[2-(4-chlorophenyl)ethyl]benzamide.
| Compound Name | 4-[2-(benzylamino)pyrimidin-5-yl]-N-[2-(4-chlorophenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 53108683 |
| Molecular Formula | C26H23ClN4O |
| Molecular Weight | 442.95 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | 4-[2-(benzylamino)pyrimidin-5-yl]-N-[2-(4-chlorophenyl)ethyl]benzamide |
| SMILES | O=C(NCCc1ccc(Cl)cc1)c1ccc(-c2cnc(NCc3ccccc3)nc2)cc1 |
| InChI | InChI=1S/C26H23ClN4O/c27-24-12-6-19(7-13-24)14-15-28-25(32)22-10-8-21(9-11-22)23-17-30-26(31-18-23)29-16-20-4-2-1-3-5-20/h1-13,17-18H,14-16H2,(H,28,32)(H,29,30,31) |
| InChIKey | XMALQSOSUUPCBM-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.95 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |