C16H14N4 — CID 3706833
5-phenyl-N-(pyridin-4-ylmethyl)pyrimidin-2-amine (PubChem CID 3706833) has the molecular formula C16H14N4 and a molecular weight of 262.32 g/mol. Its IUPAC name is 5-phenyl-N-(pyridin-4-ylmethyl)pyrimidin-2-amine.
| Compound Name | 5-phenyl-N-(pyridin-4-ylmethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 3706833 |
| Molecular Formula | C16H14N4 |
| Molecular Weight | 262.32 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 5-phenyl-N-(pyridin-4-ylmethyl)pyrimidin-2-amine |
| SMILES | c1ccc(-c2cnc(NCc3ccncc3)nc2)cc1 |
| InChI | InChI=1S/C16H14N4/c1-2-4-14(5-3-1)15-11-19-16(20-12-15)18-10-13-6-8-17-9-7-13/h1-9,11-12H,10H2,(H,18,19,20) |
| InChIKey | MOWCBUHGHYHLSY-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.32 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |