C12H12N4O2 — CID 116975760
methyl 2-[(5-pyridin-3-ylpyrimidin-2-yl)amino]acetate (PubChem CID 116975760) has the molecular formula C12H12N4O2 and a molecular weight of 244.25 g/mol. Its IUPAC name is methyl 2-[(5-pyridin-3-ylpyrimidin-2-yl)amino]acetate.
| Compound Name | methyl 2-[(5-pyridin-3-ylpyrimidin-2-yl)amino]acetate |
|---|---|
| PubChem CID | 116975760 |
| Molecular Formula | C12H12N4O2 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | methyl 2-[(5-pyridin-3-ylpyrimidin-2-yl)amino]acetate |
| SMILES | COC(=O)CNc1ncc(-c2cccnc2)cn1 |
| InChI | InChI=1S/C12H12N4O2/c1-18-11(17)8-16-12-14-6-10(7-15-12)9-3-2-4-13-5-9/h2-7H,8H2,1H3,(H,14,15,16) |
| InChIKey | JZTWXNRFOOXMEV-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |