C13H17N5 — CID 116974460
N-methyl-N'-(5-pyridin-3-ylpyrimidin-2-yl)propane-1,3-diamine (PubChem CID 116974460) has the molecular formula C13H17N5 and a molecular weight of 243.31 g/mol. Its IUPAC name is N-methyl-N'-(5-pyridin-3-ylpyrimidin-2-yl)propane-1,3-diamine.
| Compound Name | N-methyl-N'-(5-pyridin-3-ylpyrimidin-2-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 116974460 |
| Molecular Formula | C13H17N5 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | N-methyl-N'-(5-pyridin-3-ylpyrimidin-2-yl)propane-1,3-diamine |
| SMILES | CNCCCNc1ncc(-c2cccnc2)cn1 |
| InChI | InChI=1S/C13H17N5/c1-14-5-3-7-16-13-17-9-12(10-18-13)11-4-2-6-15-8-11/h2,4,6,8-10,14H,3,5,7H2,1H3,(H,16,17,18) |
| InChIKey | CMJSMRCLUIVTLF-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|