C13H17N5 — CID 63255523
N-(pyridin-3-ylmethyl)-N'-pyrimidin-2-ylpropane-1,3-diamine (PubChem CID 63255523) has the molecular formula C13H17N5 and a molecular weight of 243.31 g/mol. Its IUPAC name is N-(pyridin-3-ylmethyl)-N'-pyrimidin-2-ylpropane-1,3-diamine.
| Compound Name | N-(pyridin-3-ylmethyl)-N'-pyrimidin-2-ylpropane-1,3-diamine |
|---|---|
| PubChem CID | 63255523 |
| Molecular Formula | C13H17N5 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | N-(pyridin-3-ylmethyl)-N'-pyrimidin-2-ylpropane-1,3-diamine |
| SMILES | c1cnc(NCCCNCc2cccnc2)nc1 |
| InChI | InChI=1S/C13H17N5/c1-4-12(10-14-5-1)11-15-6-2-7-16-13-17-8-3-9-18-13/h1,3-5,8-10,15H,2,6-7,11H2,(H,16,17,18) |
| InChIKey | LCMAJPRQGZMTTI-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|