C14H19N5 — CID 102536371
N-propyl-5-[(pyridin-3-ylmethylamino)methyl]pyrimidin-2-amine (PubChem CID 102536371) has the molecular formula C14H19N5 and a molecular weight of 257.34 g/mol. Its IUPAC name is N-propyl-5-[(pyridin-3-ylmethylamino)methyl]pyrimidin-2-amine.
| Compound Name | N-propyl-5-[(pyridin-3-ylmethylamino)methyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 102536371 |
| Molecular Formula | C14H19N5 |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | N-propyl-5-[(pyridin-3-ylmethylamino)methyl]pyrimidin-2-amine |
| SMILES | CCCNc1ncc(CNCc2cccnc2)cn1 |
| InChI | InChI=1S/C14H19N5/c1-2-5-17-14-18-10-13(11-19-14)9-16-8-12-4-3-6-15-7-12/h3-4,6-7,10-11,16H,2,5,8-9H2,1H3,(H,17,18,19) |
| InChIKey | HVGFHIXASJOQSG-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |