C24H29F3N4O2 — CID 21101104
N-[3-(diethylamino)propyl]-3-ethoxy-4-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]benzamide (PubChem CID 21101104) has the molecular formula C24H29F3N4O2 and a molecular weight of 462.52 g/mol. Its IUPAC name is N-[3-(diethylamino)propyl]-3-ethoxy-4-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]benzamide.
| Compound Name | N-[3-(diethylamino)propyl]-3-ethoxy-4-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]benzamide |
|---|---|
| PubChem CID | 21101104 |
| Molecular Formula | C24H29F3N4O2 |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | N-[3-(diethylamino)propyl]-3-ethoxy-4-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]benzamide |
| SMILES | CCOc1cc(C(=O)NCCCN(CC)CC)ccc1-c1nc2ccc(C(F)(F)F)cc2[nH]1 |
| InChI | InChI=1S/C24H29F3N4O2/c1-4-31(5-2)13-7-12-28-23(32)16-8-10-18(21(14-16)33-6-3)22-29-19-11-9-17(24(25,26)27)15-20(19)30-22/h8-11,14-15H,4-7,12-13H2,1-3H3,(H,28,32)(H,29,30) |
| InChIKey | HTZDEDNBMSBLAL-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|