C25H31F3N6OS — CID 134445478
N-[3-(diethylamino)propyl]-1-methyl-2-[[2-(methylideneamino)-5-(trifluoromethyl)phenyl]sulfanylmethylamino]benzimidazole-5-carboxamide (PubChem CID 134445478) has the molecular formula C25H31F3N6OS and a molecular weight of 520.63 g/mol. Its IUPAC name is N-[3-(diethylamino)propyl]-1-methyl-2-[[2-(methylideneamino)-5-(trifluoromethyl)phenyl]sulfanylmethylamino]benzimidazole-5-carboxamide.
| Compound Name | N-[3-(diethylamino)propyl]-1-methyl-2-[[2-(methylideneamino)-5-(trifluoromethyl)phenyl]sulfanylmethylamino]benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 134445478 |
| Molecular Formula | C25H31F3N6OS |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.22 |
| IUPAC Name | N-[3-(diethylamino)propyl]-1-methyl-2-[[2-(methylideneamino)-5-(trifluoromethyl)phenyl]sulfanylmethylamino]benzimidazole-5-carboxamide |
| SMILES | C=Nc1ccc(C(F)(F)F)cc1SCNc1nc2cc(C(=O)NCCCN(CC)CC)ccc2n1C |
| InChI | InChI=1S/C25H31F3N6OS/c1-5-34(6-2)13-7-12-30-23(35)17-8-11-21-20(14-17)32-24(33(21)4)31-16-36-22-15-18(25(26,27)28)9-10-19(22)29-3/h8-11,14-15H,3,5-7,12-13,16H2,1-2,4H3,(H,30,35)(H,31,32) |
| InChIKey | NXGLRIFRERPGJU-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 74.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|