C24H28ClN5O2S — CID 134445473
2-[[5-chloro-2-(methylideneamino)phenyl]sulfanylmethylamino]-N-[(4-hydroxycyclohexyl)methyl]-1-methylbenzimidazole-5-carboxamide (PubChem CID 134445473) has the molecular formula C24H28ClN5O2S and a molecular weight of 486.04 g/mol. Its IUPAC name is 2-[[5-chloro-2-(methylideneamino)phenyl]sulfanylmethylamino]-N-[(4-hydroxycyclohexyl)methyl]-1-methylbenzimidazole-5-carboxamide.
| Compound Name | 2-[[5-chloro-2-(methylideneamino)phenyl]sulfanylmethylamino]-N-[(4-hydroxycyclohexyl)methyl]-1-methylbenzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 134445473 |
| Molecular Formula | C24H28ClN5O2S |
| Molecular Weight | 486.04 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | 2-[[5-chloro-2-(methylideneamino)phenyl]sulfanylmethylamino]-N-[(4-hydroxycyclohexyl)methyl]-1-methylbenzimidazole-5-carboxamide |
| SMILES | C=Nc1ccc(Cl)cc1SCNc1nc2cc(C(=O)NCC3CCC(O)CC3)ccc2n1C |
| InChI | InChI=1S/C24H28ClN5O2S/c1-26-19-9-6-17(25)12-22(19)33-14-28-24-29-20-11-16(5-10-21(20)30(24)2)23(32)27-13-15-3-7-18(31)8-4-15/h5-6,9-12,15,18,31H,1,3-4,7-8,13-14H2,2H3,(H,27,32)(H,28,29) |
| InChIKey | HNBNZPUHVGEZQB-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 91.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.04 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|