C23H29N3O5S — CID 70494047
methyl 2-[4-(dipropylsulfamoyl)-2-ethoxyphenyl]-3H-benzimidazole-5-carboxylate (PubChem CID 70494047) has the molecular formula C23H29N3O5S and a molecular weight of 459.57 g/mol. Its IUPAC name is methyl 2-[4-(dipropylsulfamoyl)-2-ethoxyphenyl]-3H-benzimidazole-5-carboxylate.
| Compound Name | methyl 2-[4-(dipropylsulfamoyl)-2-ethoxyphenyl]-3H-benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 70494047 |
| Molecular Formula | C23H29N3O5S |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | methyl 2-[4-(dipropylsulfamoyl)-2-ethoxyphenyl]-3H-benzimidazole-5-carboxylate |
| SMILES | CCCN(CCC)S(=O)(=O)c1ccc(-c2nc3ccc(C(=O)OC)cc3[nH]2)c(OCC)c1 |
| InChI | InChI=1S/C23H29N3O5S/c1-5-12-26(13-6-2)32(28,29)17-9-10-18(21(15-17)31-7-3)22-24-19-11-8-16(23(27)30-4)14-20(19)25-22/h8-11,14-15H,5-7,12-13H2,1-4H3,(H,24,25) |
| InChIKey | ZUKAXVAMLWQMQN-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 101.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |